| Name |
tert-Butyl (R)-6,6-difluoro-2-methyl-1,4-diazepane-1-carboxylate
|
| Molecular Formula |
C11H20F2N2O2
|
| Molecular Weight |
250.29
|
| Smiles |
CC1CNCC(F)(F)CN1C(=O)OC(C)(C)C
|
CC1CNCC(F)(F)CN1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.