| Name |
1-Isobutyl-3,5-dimethyl-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1H-pyrazole
|
| Molecular Formula |
C15H27BN2O2
|
| Molecular Weight |
278.20
|
| Smiles |
Cc1nn(CC(C)C)c(C)c1B1OC(C)(C)C(C)(C)O1
|
Cc1nn(CC(C)C)c(C)c1B1OC(C)(C)C(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.