| Name |
(E)-3-(1H-benzo[d][1,2,3]triazol-1-yl)-N'-(1-(2-hydroxyphenyl)ethylidene)propanehydrazide
|
| Molecular Formula |
C17H17N5O2
|
| Molecular Weight |
323.35
|
| Smiles |
CC(=NNC(=O)CCn1nnc2ccccc21)c1ccccc1O
|
CC(=NNC(=O)CCn1nnc2ccccc21)c1ccccc1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.