| Name |
tert-Butyl (S)-2-(Boc-amino)-4-[(2,3-Di-Boc-guanidino)oxy]butanoate
|
| Molecular Formula |
C24H44N4O9
|
| Molecular Weight |
532.6
|
| Smiles |
CC(C)(C)OC(=O)NC(=NOCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C
|
CC(C)(C)OC(=O)NC(=NOCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.