| Name |
4-{[7-(4-Pyridinylmethoxy)furo[2,3-d]pyridazin-4-yl]amino}phenol
|
| Molecular Formula |
C18H14N4O3
|
| Molecular Weight |
334.3
|
| Smiles |
Oc1ccc(Nc2nnc(OCc3ccncc3)c3occc23)cc1
|
Oc1ccc(Nc2nnc(OCc3ccncc3)c3occc23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.