| Name |
4-Cyclobutyl-6-[(1-{5-methylpyrazolo[1,5-a]pyrimidin-7-yl}piperidin-4-yl)methoxy]pyrimidine
|
| Molecular Formula |
C21H26N6O
|
| Molecular Weight |
378.5
|
| Smiles |
Cc1cc(N2CCC(COc3cc(C4CCC4)ncn3)CC2)n2nccc2n1
|
Cc1cc(N2CCC(COc3cc(C4CCC4)ncn3)CC2)n2nccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.