| Name |
2-(2-chlorophenyl)-N-{5H,6H,7H,8H-imidazo[1,5-a]pyridin-6-yl}ethene-1-sulfonamide
|
| Molecular Formula |
C15H16ClN3O2S
|
| Molecular Weight |
337.8
|
| Smiles |
O=S(=O)(C=Cc1ccccc1Cl)NC1CCc2cncn2C1
|
O=S(=O)(C=Cc1ccccc1Cl)NC1CCc2cncn2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.