| Name |
2-Tert-butyl 8-methyl 6-(aminomethyl)-1h,2h,3h,4h-pyrrolo[1,2-a]pyrazine-2,8-dicarboxylate
|
| Molecular Formula |
C15H23N3O4
|
| Molecular Weight |
309.36
|
| Smiles |
COC(=O)c1cc(CN)n2c1CN(C(=O)OC(C)(C)C)CC2
|
COC(=O)c1cc(CN)n2c1CN(C(=O)OC(C)(C)C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.