| Name |
6-(4-Methoxyphenyl)-2-(2-{[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]amino}ethyl)-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C19H16F3N7O2
|
| Molecular Weight |
431.4
|
| Smiles |
COc1ccc(-c2ccc(=O)n(CCNc3ccc4nnc(C(F)(F)F)n4n3)n2)cc1
|
COc1ccc(-c2ccc(=O)n(CCNc3ccc4nnc(C(F)(F)F)n4n3)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.