| Name |
6-(4-Fluorophenyl)-2-[(1-{[1,3]thiazolo[4,5-c]pyridin-2-yl}piperidin-4-yl)methyl]-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C22H20FN5OS
|
| Molecular Weight |
421.5
|
| Smiles |
O=c1ccc(-c2ccc(F)cc2)nn1CC1CCN(c2nc3cnccc3s2)CC1
|
O=c1ccc(-c2ccc(F)cc2)nn1CC1CCN(c2nc3cnccc3s2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.