| Name |
N-[(6-Methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methyl]prop-2-enamide
|
| Molecular Formula |
C12H16N2OS
|
| Molecular Weight |
236.34
|
| Smiles |
C=CC(=O)NCc1nc2c(s1)CC(C)CC2
|
C=CC(=O)NCc1nc2c(s1)CC(C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.