| Name |
2,4,5-trimethyl-N-{[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl}benzene-1-sulfonamide
|
| Molecular Formula |
C17H25F3N2O2S
|
| Molecular Weight |
378.5
|
| Smiles |
Cc1cc(C)c(S(=O)(=O)NCC2CCN(CC(F)(F)F)CC2)cc1C
|
Cc1cc(C)c(S(=O)(=O)NCC2CCN(CC(F)(F)F)CC2)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.