| Name |
4-bromo-1-({4H,5H,6H-cyclopenta[d][1,3]thiazol-2-yl}methyl)-1H-pyrazole
|
| Molecular Formula |
C10H10BrN3S
|
| Molecular Weight |
284.18
|
| Smiles |
Brc1cnn(Cc2nc3c(s2)CCC3)c1
|
Brc1cnn(Cc2nc3c(s2)CCC3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.