| Name |
1-Methyl-4-({[3-(trifluoromethyl)phenyl]methyl}sulfanyl)-[1,2,4]triazolo[4,3-a]quinoxaline
|
| Molecular Formula |
C18H13F3N4S
|
| Molecular Weight |
374.4
|
| Smiles |
Cc1nnc2c(SCc3cccc(C(F)(F)F)c3)nc3ccccc3n12
|
Cc1nnc2c(SCc3cccc(C(F)(F)F)c3)nc3ccccc3n12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.