| Name |
7-(Azepan-1-yl)-3-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-1,4-dihydroquinolin-4-one
|
| Molecular Formula |
C28H30FN3O3S
|
| Molecular Weight |
507.6
|
| Smiles |
CCn1cc(-c2nc(-c3ccc(OC)c(OC)c3)cs2)c(=O)c2cc(F)c(N3CCCCCC3)cc21
|
CCn1cc(-c2nc(-c3ccc(OC)c(OC)c3)cs2)c(=O)c2cc(F)c(N3CCCCCC3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.