| Name |
N-[(1R,2R)-2-[(4-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)methyl]cyclohexyl]but-2-ynamide
|
| Molecular Formula |
C14H20N4O2
|
| Molecular Weight |
276.33
|
| Smiles |
CC#CC(=O)NC1CCCCC1Cc1n[nH]c(=O)n1C
|
CC#CC(=O)NC1CCCCC1Cc1n[nH]c(=O)n1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.