| Name |
6-(m-tolyl)-1H-pyrrolo[3,2-b]pyridine
|
| Molecular Formula |
C14H12N2
|
| Molecular Weight |
208.26
|
| Smiles |
Cc1cccc(-c2cnc3cc[nH]c3c2)c1
|
Cc1cccc(-c2cnc3cc[nH]c3c2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.