| Name |
5-Bromo-2-chloro-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester
|
| Molecular Formula |
C11H7BrClNO4
|
| Molecular Weight |
332.53
|
| Smiles |
O=C(ON1C(=O)CCC1=O)c1cc(Br)ccc1Cl
|
O=C(ON1C(=O)CCC1=O)c1cc(Br)ccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.