| Name |
(3S)-3-Amino-1,1,1-trifluoro-2-butanol tosylate
|
| Molecular Formula |
C11H16F3NO4S
|
| Molecular Weight |
315.31
|
| Smiles |
CC(N)C(O)C(F)(F)F.Cc1ccc(S(=O)(=O)O)cc1
|
CC(N)C(O)C(F)(F)F.Cc1ccc(S(=O)(=O)O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.