| Name |
2,4-Difluoro-3-(1H-1,2,4-triazol-3-yl)aniline
|
| Molecular Formula |
C8H6F2N4
|
| Molecular Weight |
196.16
|
| Smiles |
Nc1ccc(F)c(-c2ncn[nH]2)c1F
|
Nc1ccc(F)c(-c2ncn[nH]2)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.