| Name |
3-Cyclopropyl-5-[(3S,4S)-4-cyclopropylpyrrolidin-3-yl]-1H-1,2,4-triazole;dihydrochloride
|
| Molecular Formula |
C12H20Cl2N4
|
| Molecular Weight |
291.22
|
| Smiles |
C1CC1c1n[nH]c(C2CNCC2C2CC2)n1.Cl.Cl
|
C1CC1c1n[nH]c(C2CNCC2C2CC2)n1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.