| Name |
N-(4-chlorobenzyl)-2-{[6-(2-methoxybenzyl)-4-oxo-3,4,5,6,7,8-hexahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C24H25ClN4O3S
|
| Molecular Weight |
485.0
|
| Smiles |
COc1ccccc1CN1CCc2nc(SCC(=O)NCc3ccc(Cl)cc3)[nH]c(=O)c2C1
|
COc1ccccc1CN1CCc2nc(SCC(=O)NCc3ccc(Cl)cc3)[nH]c(=O)c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.