| Name |
(2-(4-Chlorophenyl)-4,4-dimethylcyclohex-1-enyl)methyl methanesulfonate
|
| Molecular Formula |
C16H21ClO3S
|
| Molecular Weight |
328.9
|
| Smiles |
CC1(C)CCC(COS(C)(=O)=O)=C(c2ccc(Cl)cc2)C1
|
CC1(C)CCC(COS(C)(=O)=O)=C(c2ccc(Cl)cc2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.