| Name |
6-cyclopropyl-3-{2-[3-(2-cyclopropyl-1H-1,3-benzodiazol-1-yl)azetidin-1-yl]-2-oxoethyl}-3,4-dihydropyrimidin-4-one
|
| Molecular Formula |
C22H23N5O2
|
| Molecular Weight |
389.4
|
| Smiles |
O=C(Cn1cnc(C2CC2)cc1=O)N1CC(n2c(C3CC3)nc3ccccc32)C1
|
O=C(Cn1cnc(C2CC2)cc1=O)N1CC(n2c(C3CC3)nc3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.