| Name |
5-(3-Chlorophenyl)-6,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-4(5H)-one
|
| Molecular Formula |
C12H10ClN3O
|
| Molecular Weight |
247.68
|
| Smiles |
O=c1[nH]cnc2c1C(c1cccc(Cl)c1)CN2
|
O=c1[nH]cnc2c1C(c1cccc(Cl)c1)CN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.