| Name |
Ethyl 4,5,6,7-Tetrahydrooxazolo[4,5-C]Pyridine-2-Carboxylate Hydrochloride
|
| Molecular Formula |
C9H13ClN2O3
|
| Molecular Weight |
232.66
|
| Smiles |
CCOC(=O)c1nc2c(o1)CCNC2.Cl
|
CCOC(=O)c1nc2c(o1)CCNC2.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.