| Name |
2-(4-Methylpiperidin-1-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one
|
| Molecular Formula |
C13H20N4O
|
| Molecular Weight |
248.32
|
| Smiles |
CC1CCN(c2nc3c(c(=O)[nH]2)CNCC3)CC1
|
CC1CCN(c2nc3c(c(=O)[nH]2)CNCC3)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.