| Name |
Tert-butyl 2-amino-5-methyl-1,3-oxazole-4-carboxylate
|
| Molecular Formula |
C9H14N2O3
|
| Molecular Weight |
198.22
|
| Smiles |
Cc1oc(N)nc1C(=O)OC(C)(C)C
|
Cc1oc(N)nc1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.