| Name |
3-bromo-6-ethyl-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine-5,7-dione
|
| Molecular Formula |
C8H8BrN3O2
|
| Molecular Weight |
258.07
|
| Smiles |
CCC1C(=O)Nc2c(Br)cnn2C1=O
|
CCC1C(=O)Nc2c(Br)cnn2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.