| Name |
2-({[4-(Dimethylamino)-6-(methylthio)-1,3,5-triazin-2-yl]amino}methylidene)-4,4,4-trifluoro-1-(2-thienyl)butane-1,3-dione
|
| Molecular Formula |
C15H14F3N5O2S2
|
| Molecular Weight |
417.4
|
| Smiles |
CSc1nc(N=CC(C(=O)C(F)(F)F)=C(O)c2cccs2)nc(N(C)C)n1
|
CSc1nc(N=CC(C(=O)C(F)(F)F)=C(O)c2cccs2)nc(N(C)C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.