| Name |
2-((6-benzyl-4-oxo-3,4,5,6,7,8-hexahydropyrido[4,3-d]pyrimidin-2-yl)thio)-N-(m-tolyl)acetamide
|
| Molecular Formula |
C23H24N4O2S
|
| Molecular Weight |
420.5
|
| Smiles |
Cc1cccc(NC(=O)CSc2nc3c(c(=O)[nH]2)CN(Cc2ccccc2)CC3)c1
|
Cc1cccc(NC(=O)CSc2nc3c(c(=O)[nH]2)CN(Cc2ccccc2)CC3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.