| Name |
3-Benzyl-1,1-dimethyl-1,2,3,4-tetrahydrobenzo[d][1,3]azasiline
|
| Molecular Formula |
C17H21NSi
|
| Molecular Weight |
267.44
|
| Smiles |
C[Si]1(C)CN(Cc2ccccc2)Cc2ccccc21
|
C[Si]1(C)CN(Cc2ccccc2)Cc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.