| Name |
2-(5-(thiophen-3-yl)-5,10b-dihydro-1H-benzo[e]pyrazolo[1,5-c][1,3]oxazin-2-yl)benzene-1,4-diol
|
| Molecular Formula |
C20H16N2O3S
|
| Molecular Weight |
364.4
|
| Smiles |
Oc1ccc(O)c(C2=NN3C(C2)c2ccccc2OC3c2ccsc2)c1
|
Oc1ccc(O)c(C2=NN3C(C2)c2ccccc2OC3c2ccsc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.