| Name |
11-Benzyl-5-[ethyl(propyl)amino]-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),5-trien-3-one
|
| Molecular Formula |
C27H30N4OS
|
| Molecular Weight |
458.6
|
| Smiles |
CCCN(CC)c1nc2sc3c(c2c(=O)n1-c1ccccc1)CCN(Cc1ccccc1)C3
|
CCCN(CC)c1nc2sc3c(c2c(=O)n1-c1ccccc1)CCN(Cc1ccccc1)C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.