| Name |
N-((11bS)-4-((2,6-bis(3,5-diethylphenyl)-4-(((trifluoromethyl)sulfonyl)imino)-4lambda5-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-yl)imino)-2,6-bis(3,5-diethylphenyl)-4lambda5-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-yl)-1,1,1-trifluoromethanesulfonamide
|
| Molecular Formula |
C82H73F6N3O8P2S2
|
| Molecular Weight |
1468.5
|
| Smiles |
CCc1cc(CC)cc(-c2cc3ccccc3c3c2OP(=NS(=O)(=O)C(F)(F)F)(N=P2(NS(=O)(=O)C(F)(F)F)Oc4c(-c5cc(CC)cc(CC)c5)cc5ccccc5c4-c4c(c(-c5cc(CC)cc(CC)c5)cc5ccccc45)O2)Oc2c(-c4cc(CC)cc(CC)c4)cc4ccccc4c2-3)c1
|
CCc1cc(CC)cc(-c2cc3ccccc3c3c2OP(=NS(=O)(=O)C(F)(F)F)(N=P2(NS(=O)(=O)C(F)(F)F)Oc4c(-c5cc(CC)cc(CC)c5)cc5ccccc5c4-c4c(c(-c5cc(CC)cc(CC)c5)cc5ccccc45)O2)Oc2c(-c4cc(CC)cc(CC)c4)cc4ccccc4c2-3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.