| Name |
15,31,47-Trichloro-4,20,36-tris(pent-2-enyl)-5,21,37-trioxatetracyclo[43.3.0.013,17.029,33]octatetraconta-1,10,14,17,26,30,33,42,46-nonaene-6,16,22,32,38,48-hexone
|
| Molecular Formula |
C60H75Cl3O9
|
| Molecular Weight |
1046.6
|
| Smiles |
CCC=CCC1CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)OC(CC=CCC)CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)OC(CC=CCC)CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)O1
|
CCC=CCC1CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)OC(CC=CCC)CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)OC(CC=CCC)CC=C2C(=O)C(Cl)=CC2CC=CCCCC(=O)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.