| Name |
Tert-butyl (S)-2-(4-(4-iodophenyl)-2,3,9-trimethyl-6H-thieno[3,2-F][1,2,4]triazolo[4,3-A][1,4]diazepin-6-YL)acetate
|
| Molecular Formula |
C23H25IN4O2S
|
| Molecular Weight |
548.4
|
| Smiles |
Cc1sc2c(c1C)C(c1ccc(I)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2
|
Cc1sc2c(c1C)C(c1ccc(I)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.