| Name | Tert-butyl (S)-2-(4-(4-iodophenyl)-2,3,9-trimethyl-6H-thieno[3,2-F][1,2,4]triazolo[4,3-A][1,4]diazepin-6-YL)acetate | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C23H25IN4O2S | 
                        
                        
                            | Molecular Weight | 548.4 | 
                        
                        
                            | Smiles | Cc1sc2c(c1C)C(c1ccc(I)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        Cc1sc2c(c1C)C(c1ccc(I)cc1)=NC(CC(=O)OC(C)(C)C)c1nnc(C)n1-2
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.