| Name |
1,3-Diphenyl-1,2-dihydro-4H-pyrazolo[4,3-c]quinolin-4-one
|
| Molecular Formula |
C22H15N3O
|
| Molecular Weight |
337.4
|
| Smiles |
O=c1[nH]c2ccccc2c2c1c(-c1ccccc1)nn2-c1ccccc1
|
O=c1[nH]c2ccccc2c2c1c(-c1ccccc1)nn2-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.