| Name |
[2,2a(2)-Binaphthalene]-7,7a(2)(8H,8a(2)H)-dione, 8,8a(2)-bis[[[4-(1,1-dimethylethyl)cyclohexyl]amino]methylene]-1,1a(2),6,6a(2)-tetrahydroxy-3,3a(2)-dimethyl-5,5a(2)-bis(1-methylethyl)-
|
| Molecular Formula |
C50H68N2O6
|
| Molecular Weight |
793.1
|
| Smiles |
Cc1cc2c(C(C)C)c(O)c(O)c(C=NC3CCC(C(C)(C)C)CC3)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=NC3CCC(C(C)(C)C)CC3)c2c1O
|
Cc1cc2c(C(C)C)c(O)c(O)c(C=NC3CCC(C(C)(C)C)CC3)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=NC3CCC(C(C)(C)C)CC3)c2c1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.