| Name |
3-(2-Hydroxyphenyl)-5-(2-methoxyethyl)-4-(4-pentoxyphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one
|
| Molecular Formula |
C25H33N3O4
|
| Molecular Weight |
439.5
|
| Smiles |
CCCCCOc1ccc(C2C3C(NNC3c3ccccc3O)C(=O)N2CCOC)cc1
|
CCCCCOc1ccc(C2C3C(NNC3c3ccccc3O)C(=O)N2CCOC)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.