| Name |
2-(3,5-dimethoxyphenyl)-6,6-dimethyl-9-(m-tolyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8(4H)-one
|
| Molecular Formula |
C26H28N4O3
|
| Molecular Weight |
444.5
|
| Smiles |
COc1cc(OC)cc(-c2nc3n(n2)C(c2cccc(C)c2)C2=C(CC(C)(C)CC2=O)N3)c1
|
COc1cc(OC)cc(-c2nc3n(n2)C(c2cccc(C)c2)C2=C(CC(C)(C)CC2=O)N3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.