| Name |
7-(2,3-dimethoxyphenyl)-6-(3,4-dimethoxyphenyl)-7,12-dihydro-6H-chromeno[4,3-d][1,2,4]triazolo[1,5-a]pyrimidine
|
| Molecular Formula |
C28H26N4O5
|
| Molecular Weight |
498.5
|
| Smiles |
COc1ccc(C2Oc3ccccc3C3=C2C(c2cccc(OC)c2OC)n2ncnc2N3)cc1OC
|
COc1ccc(C2Oc3ccccc3C3=C2C(c2cccc(OC)c2OC)n2ncnc2N3)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.