| Name |
2-(trifluoromethyl)-6-({1-[(1,3,5-trimethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl}methoxy)pyridine
|
| Molecular Formula |
C18H23F3N4O3S
|
| Molecular Weight |
432.5
|
| Smiles |
Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(COc2cccc(C(F)(F)F)n2)CC1
|
Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(COc2cccc(C(F)(F)F)n2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.