| Name |
N-({[(furan-2-yl)methyl]carbamothioyl}amino)-1-methyl-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C10H12N6O2S
|
| Molecular Weight |
280.31
|
| Smiles |
Cn1cc(C(=O)NNC(=S)NCc2ccco2)nn1
|
Cn1cc(C(=O)NNC(=S)NCc2ccco2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.