| Name |
2-[(5-Methyl-1,2-oxazol-3-yl)methyl]-1,4-dihydroisoquinolin-3-one
|
| Molecular Formula |
C14H14N2O2
|
| Molecular Weight |
242.27
|
| Smiles |
Cc1cc(CN2Cc3ccccc3CC2=O)no1
|
Cc1cc(CN2Cc3ccccc3CC2=O)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.