| Name |
(5'R,7alpha)-Sirodesmin C
|
| Molecular Formula |
C20H26N2O8S3
|
| Molecular Weight |
518.6
|
| Smiles |
CC(=O)OC1C2(CC3N4C(=O)C5(CO)SSSC4(CC31O)C(=O)N5C)OC(C)C(C)(C)C2=O
|
CC(=O)OC1C2(CC3N4C(=O)C5(CO)SSSC4(CC31O)C(=O)N5C)OC(C)C(C)(C)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.