| Name |
4,4',5,5'-Tetrahydro-2'H,3H-spiro[benzo[f][1,4]oxazepine-2,3'-furan]
|
| Molecular Formula |
C12H15NO2
|
| Molecular Weight |
205.25
|
| Smiles |
c1ccc2c(c1)CNCC1(CCOC1)O2
|
c1ccc2c(c1)CNCC1(CCOC1)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.