| Name |
(3AS,4R,6S,6aS)-6-methoxy-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carbaldehyde
|
| Molecular Formula |
C9H14O5
|
| Molecular Weight |
202.20
|
| Smiles |
COC1OC(C=O)C2OC(C)(C)OC12
|
COC1OC(C=O)C2OC(C)(C)OC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.