| Name |
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-hydroxy-2,4-dioxopyrimidine-5-carboxylic acid
|
| Molecular Formula |
C10H13N2O12P
|
| Molecular Weight |
384.19
|
| Smiles |
O=C(O)c1c(O)n(C2OC(COP(=O)(O)O)C(O)C2O)c(=O)[nH]c1=O
|
O=C(O)c1c(O)n(C2OC(COP(=O)(O)O)C(O)C2O)c(=O)[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.