| Name |
6-bromo-2-{6-[4-(propan-2-yl)-4H-1,2,4-triazol-3-yl]pyridin-2-yl}-2,3-dihydro-1H-isoindol-1-one
|
| Molecular Formula |
C18H16BrN5O
|
| Molecular Weight |
398.3
|
| Smiles |
CC(C)n1cnnc1-c1cccc(N2Cc3ccc(Br)cc3C2=O)n1
|
CC(C)n1cnnc1-c1cccc(N2Cc3ccc(Br)cc3C2=O)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.